C19H26BrNO2 — CID 1314158
2-(2-bromo-4-propan-2-ylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 1314158) has the molecular formula C19H26BrNO2 and a molecular weight of 380.33 g/mol. Its IUPAC name is 2-(2-bromo-4-propan-2-ylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-(2-bromo-4-propan-2-ylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 1314158 |
| Molecular Formula | C19H26BrNO2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-(2-bromo-4-propan-2-ylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | CC(C)c1ccc(OCC(=O)NCCC2=CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C19H26BrNO2/c1-14(2)16-8-9-18(17(20)12-16)23-13-19(22)21-11-10-15-6-4-3-5-7-15/h6,8-9,12,14H,3-5,7,10-11,13H2,1-2H3,(H,21,22) |
| InChIKey | ZSGITTQJLLZRAD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|