C17H17N3O4S — CID 9141494
2-(2-cyanophenoxy)-N-(2,3-dimethyl-5-sulfamoylphenyl)acetamide (PubChem CID 9141494) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-(2,3-dimethyl-5-sulfamoylphenyl)acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-(2,3-dimethyl-5-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 9141494 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-(2,3-dimethyl-5-sulfamoylphenyl)acetamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)COc2ccccc2C#N)c1C |
| InChI | InChI=1S/C17H17N3O4S/c1-11-7-14(25(19,22)23)8-15(12(11)2)20-17(21)10-24-16-6-4-3-5-13(16)9-18/h3-8H,10H2,1-2H3,(H,20,21)(H2,19,22,23) |
| InChIKey | PYNDWVANTSFZFD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |