C12H18ClNO2S2 — CID 115700723
2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-(2-hydroxypentyl)acetamide (PubChem CID 115700723) has the molecular formula C12H18ClNO2S2 and a molecular weight of 307.87 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-(2-hydroxypentyl)acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-(2-hydroxypentyl)acetamide |
|---|---|
| PubChem CID | 115700723 |
| Molecular Formula | C12H18ClNO2S2 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-(2-hydroxypentyl)acetamide |
| SMILES | CCCC(O)CNC(=O)CSCc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H18ClNO2S2/c1-2-3-9(15)6-14-12(16)8-17-7-10-4-5-11(13)18-10/h4-5,9,15H,2-3,6-8H2,1H3,(H,14,16) |
| InChIKey | DJSIIHJEQFHZEM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |