C13H18ClNO3S2 — CID 79039019
2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[(4-hydroxyoxan-4-yl)methyl]acetamide (PubChem CID 79039019) has the molecular formula C13H18ClNO3S2 and a molecular weight of 335.88 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[(4-hydroxyoxan-4-yl)methyl]acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[(4-hydroxyoxan-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 79039019 |
| Molecular Formula | C13H18ClNO3S2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[(4-hydroxyoxan-4-yl)methyl]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)s1)NCC1(O)CCOCC1 |
| InChI | InChI=1S/C13H18ClNO3S2/c14-11-2-1-10(20-11)7-19-8-12(16)15-9-13(17)3-5-18-6-4-13/h1-2,17H,3-9H2,(H,15,16) |
| InChIKey | AMFWAHRDVZYXFM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |