C14H19ClN2O3S — CID 56815659
4-[[3-(5-chlorothiophen-2-yl)propanoylamino]methyl]oxane-4-carboxamide (PubChem CID 56815659) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is 4-[[3-(5-chlorothiophen-2-yl)propanoylamino]methyl]oxane-4-carboxamide.
| Compound Name | 4-[[3-(5-chlorothiophen-2-yl)propanoylamino]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 56815659 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-[[3-(5-chlorothiophen-2-yl)propanoylamino]methyl]oxane-4-carboxamide |
| SMILES | NC(=O)C1(CNC(=O)CCc2ccc(Cl)s2)CCOCC1 |
| InChI | InChI=1S/C14H19ClN2O3S/c15-11-3-1-10(21-11)2-4-12(18)17-9-14(13(16)19)5-7-20-8-6-14/h1,3H,2,4-9H2,(H2,16,19)(H,17,18) |
| InChIKey | OQOKMSXZWGAKRQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |