C14H20ClNO3S — CID 95632333
3-(5-chlorothiophen-2-yl)-N-[(2R)-2-hydroxy-2-(oxan-4-yl)ethyl]propanamide (PubChem CID 95632333) has the molecular formula C14H20ClNO3S and a molecular weight of 317.84 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-[(2R)-2-hydroxy-2-(oxan-4-yl)ethyl]propanamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-[(2R)-2-hydroxy-2-(oxan-4-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 95632333 |
| Molecular Formula | C14H20ClNO3S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-[(2R)-2-hydroxy-2-(oxan-4-yl)ethyl]propanamide |
| SMILES | O=C(CCc1ccc(Cl)s1)NC[C@H](O)C1CCOCC1 |
| InChI | InChI=1S/C14H20ClNO3S/c15-13-3-1-11(20-13)2-4-14(18)16-9-12(17)10-5-7-19-8-6-10/h1,3,10,12,17H,2,4-9H2,(H,16,18)/t12-/m0/s1 |
| InChIKey | SBUCIDMZGOUKBZ-LBPRGKRZSA-N |
| XLogP | 2.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |