C12H18ClNOS — CID 111425399
2-[(5-chlorothiophen-2-yl)methylamino]-1-cyclopentylethanol (PubChem CID 111425399) has the molecular formula C12H18ClNOS and a molecular weight of 259.80 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methylamino]-1-cyclopentylethanol.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methylamino]-1-cyclopentylethanol |
|---|---|
| PubChem CID | 111425399 |
| Molecular Formula | C12H18ClNOS |
| Molecular Weight | 259.80 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methylamino]-1-cyclopentylethanol |
| SMILES | OC(CNCc1ccc(Cl)s1)C1CCCC1 |
| InChI | InChI=1S/C12H18ClNOS/c13-12-6-5-10(16-12)7-14-8-11(15)9-3-1-2-4-9/h5-6,9,11,14-15H,1-4,7-8H2 |
| InChIKey | GBIJEWVVZHDQHK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.80 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |