C16H23ClOS — CID 115785914
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(5-chlorothiophen-2-yl)ethanol (PubChem CID 115785914) has the molecular formula C16H23ClOS and a molecular weight of 298.88 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(5-chlorothiophen-2-yl)ethanol.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(5-chlorothiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 115785914 |
| Molecular Formula | C16H23ClOS |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(5-chlorothiophen-2-yl)ethanol |
| SMILES | OC(Cc1ccc(Cl)s1)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H23ClOS/c17-16-8-7-14(19-16)10-15(18)13-6-5-11-3-1-2-4-12(11)9-13/h7-8,11-13,15,18H,1-6,9-10H2 |
| InChIKey | QIDHTDDHDGSLEK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |