C20H26ClN3OS — CID 60511690
3-(5-chlorothiophen-2-yl)-N-[2-(4-phenylpiperazin-1-yl)propyl]propanamide (PubChem CID 60511690) has the molecular formula C20H26ClN3OS and a molecular weight of 391.97 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-[2-(4-phenylpiperazin-1-yl)propyl]propanamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-[2-(4-phenylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 60511690 |
| Molecular Formula | C20H26ClN3OS |
| Molecular Weight | 391.97 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-[2-(4-phenylpiperazin-1-yl)propyl]propanamide |
| SMILES | CC(CNC(=O)CCc1ccc(Cl)s1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H26ClN3OS/c1-16(15-22-20(25)10-8-18-7-9-19(21)26-18)23-11-13-24(14-12-23)17-5-3-2-4-6-17/h2-7,9,16H,8,10-15H2,1H3,(H,22,25) |
| InChIKey | QHXMQAKZKPDORW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.97 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |