C26H38N4O3S — CID 51658596
3-[4-(diethylsulfamoyl)phenyl]-N-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]propanamide (PubChem CID 51658596) has the molecular formula C26H38N4O3S and a molecular weight of 486.68 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]propanamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 51658596 |
| Molecular Formula | C26H38N4O3S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-[(2R)-2-(4-phenylpiperazin-1-yl)propyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)NC[C@@H](C)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H38N4O3S/c1-4-30(5-2)34(32,33)25-14-11-23(12-15-25)13-16-26(31)27-21-22(3)28-17-19-29(20-18-28)24-9-7-6-8-10-24/h6-12,14-15,22H,4-5,13,16-21H2,1-3H3,(H,27,31)/t22-/m1/s1 |
| InChIKey | IMPZWGPIQRWQAG-JOCHJYFZSA-N |
| XLogP | 2.98 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |