C12H10Cl2N2OS2 — CID 34136142
N-(5-chloro-2-pyridinyl)-2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetamide (PubChem CID 34136142) has the molecular formula C12H10Cl2N2OS2 and a molecular weight of 333.27 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 34136142 |
| Molecular Formula | C12H10Cl2N2OS2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)s1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C12H10Cl2N2OS2/c13-8-1-4-11(15-5-8)16-12(17)7-18-6-9-2-3-10(14)19-9/h1-5H,6-7H2,(H,15,16,17) |
| InChIKey | OZUJGIXNAHQNEB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |