C12H12ClN3O3S2 — CID 61017351
2-[4-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]pyrazol-1-yl]acetic acid (PubChem CID 61017351) has the molecular formula C12H12ClN3O3S2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 2-[4-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 61017351 |
| Molecular Formula | C12H12ClN3O3S2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2-[4-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(NC(=O)CSCc2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C12H12ClN3O3S2/c13-10-2-1-9(21-10)6-20-7-11(17)15-8-3-14-16(4-8)5-12(18)19/h1-4H,5-7H2,(H,15,17)(H,18,19) |
| InChIKey | XZQKXHONGJXFTI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |