C12H10Cl2N4O3 — CID 65499226
2-[4-[(2,6-dichlorophenyl)carbamoylamino]pyrazol-1-yl]acetic acid (PubChem CID 65499226) has the molecular formula C12H10Cl2N4O3 and a molecular weight of 329.14 g/mol. Its IUPAC name is 2-[4-[(2,6-dichlorophenyl)carbamoylamino]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[(2,6-dichlorophenyl)carbamoylamino]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 65499226 |
| Molecular Formula | C12H10Cl2N4O3 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-[4-[(2,6-dichlorophenyl)carbamoylamino]pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(NC(=O)Nc2c(Cl)cccc2Cl)cn1 |
| InChI | InChI=1S/C12H10Cl2N4O3/c13-8-2-1-3-9(14)11(8)17-12(21)16-7-4-15-18(5-7)6-10(19)20/h1-5H,6H2,(H,19,20)(H2,16,17,21) |
| InChIKey | GBFYCVWUGOFKKA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |