C10H13F3N4O3 — CID 115521189
2-[4-(4,4,4-trifluorobutylcarbamoylamino)pyrazol-1-yl]acetic acid (PubChem CID 115521189) has the molecular formula C10H13F3N4O3 and a molecular weight of 294.23 g/mol. Its IUPAC name is 2-[4-(4,4,4-trifluorobutylcarbamoylamino)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-(4,4,4-trifluorobutylcarbamoylamino)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115521189 |
| Molecular Formula | C10H13F3N4O3 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-[4-(4,4,4-trifluorobutylcarbamoylamino)pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(NC(=O)NCCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C10H13F3N4O3/c11-10(12,13)2-1-3-14-9(20)16-7-4-15-17(5-7)6-8(18)19/h4-5H,1-3,6H2,(H,18,19)(H2,14,16,20) |
| InChIKey | DZCBLGMYMKWZNN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|