C11H16N4O3S — CID 80586575
2-[4-(thiolan-2-ylmethylcarbamoylamino)pyrazol-1-yl]acetic acid (PubChem CID 80586575) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-[4-(thiolan-2-ylmethylcarbamoylamino)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-(thiolan-2-ylmethylcarbamoylamino)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 80586575 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-[4-(thiolan-2-ylmethylcarbamoylamino)pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(NC(=O)NCC2CCCS2)cn1 |
| InChI | InChI=1S/C11H16N4O3S/c16-10(17)7-15-6-8(4-13-15)14-11(18)12-5-9-2-1-3-19-9/h4,6,9H,1-3,5,7H2,(H,16,17)(H2,12,14,18) |
| InChIKey | FWQQNJRSPKFFJB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |