C13H11ClN2O3S2 — CID 63153997
5-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]pyridine-3-carboxylic acid (PubChem CID 63153997) has the molecular formula C13H11ClN2O3S2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 5-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 5-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63153997 |
| Molecular Formula | C13H11ClN2O3S2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 5-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]pyridine-3-carboxylic acid |
| SMILES | O=C(CSCc1ccc(Cl)s1)Nc1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C13H11ClN2O3S2/c14-11-2-1-10(21-11)6-20-7-12(17)16-9-3-8(13(18)19)4-15-5-9/h1-5H,6-7H2,(H,16,17)(H,18,19) |
| InChIKey | FEOARYGJVKSTRM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |