C14H11ClF3NO2S2 — CID 38206399
2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 38206399) has the molecular formula C14H11ClF3NO2S2 and a molecular weight of 381.83 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 38206399 |
| Molecular Formula | C14H11ClF3NO2S2 |
| Molecular Weight | 381.83 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)s1)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H11ClF3NO2S2/c15-12-5-4-11(23-12)7-22-8-13(20)19-9-2-1-3-10(6-9)21-14(16,17)18/h1-6H,7-8H2,(H,19,20) |
| InChIKey | FNSYFVUDPOHTRG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |