C16H21F3N2O4S — CID 84551861
tert-butyl N-[2-[2-oxo-2-[3-(trifluoromethoxy)anilino]ethyl]sulfanylethyl]carbamate (PubChem CID 84551861) has the molecular formula C16H21F3N2O4S and a molecular weight of 394.42 g/mol. Its IUPAC name is tert-butyl N-[2-[2-oxo-2-[3-(trifluoromethoxy)anilino]ethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-oxo-2-[3-(trifluoromethoxy)anilino]ethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84551861 |
| Molecular Formula | C16H21F3N2O4S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | tert-butyl N-[2-[2-oxo-2-[3-(trifluoromethoxy)anilino]ethyl]sulfanylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSCC(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2O4S/c1-15(2,3)25-14(23)20-7-8-26-10-13(22)21-11-5-4-6-12(9-11)24-16(17,18)19/h4-6,9H,7-8,10H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | LGRNZJSUQPLBID-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|