C17H23F3N2O3S — CID 84557459
tert-butyl N-[2-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]sulfanylethyl]carbamate (PubChem CID 84557459) has the molecular formula C17H23F3N2O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is tert-butyl N-[2-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84557459 |
| Molecular Formula | C17H23F3N2O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | tert-butyl N-[2-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]sulfanylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSCC(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3N2O3S/c1-16(2,3)25-15(24)21-7-8-26-11-14(23)22-10-12-5-4-6-13(9-12)17(18,19)20/h4-6,9H,7-8,10-11H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | ZMRICIUOSCVIMV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|