C20H21F3N2O3 — CID 24536954
tert-butyl N-[3-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]carbamate (PubChem CID 24536954) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is tert-butyl N-[3-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 24536954 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | tert-butyl N-[3-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)NCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H21F3N2O3/c1-19(2,3)28-18(27)25-16-9-5-7-14(11-16)17(26)24-12-13-6-4-8-15(10-13)20(21,22)23/h4-11H,12H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | RCLIVLKGEBZSLJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |