C20H21F3N2O4 — CID 34555235
tert-butyl N-[3-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]phenyl]carbamate (PubChem CID 34555235) has the molecular formula C20H21F3N2O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 34555235 |
| Molecular Formula | C20H21F3N2O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | tert-butyl N-[3-[[2-(trifluoromethoxy)phenyl]methylcarbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)NCc2ccccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N2O4/c1-19(2,3)29-18(27)25-15-9-6-8-13(11-15)17(26)24-12-14-7-4-5-10-16(14)28-20(21,22)23/h4-11H,12H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | SQHDLPWFUBCUBW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |