C16H21F3N2O4 — CID 34555299
tert-butyl N-[3-oxo-3-[[2-(trifluoromethoxy)phenyl]methylamino]propyl]carbamate (PubChem CID 34555299) has the molecular formula C16H21F3N2O4 and a molecular weight of 362.35 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[[2-(trifluoromethoxy)phenyl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[[2-(trifluoromethoxy)phenyl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 34555299 |
| Molecular Formula | C16H21F3N2O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[[2-(trifluoromethoxy)phenyl]methylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H21F3N2O4/c1-15(2,3)25-14(23)20-9-8-13(22)21-10-11-6-4-5-7-12(11)24-16(17,18)19/h4-7H,8-10H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | OBHYQWRTFGJFHP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |