C16H15F3N2O4 — CID 17464973
N-[3-oxo-3-[[2-(trifluoromethoxy)phenyl]methylamino]propyl]furan-2-carboxamide (PubChem CID 17464973) has the molecular formula C16H15F3N2O4 and a molecular weight of 356.30 g/mol. Its IUPAC name is N-[3-oxo-3-[[2-(trifluoromethoxy)phenyl]methylamino]propyl]furan-2-carboxamide.
| Compound Name | N-[3-oxo-3-[[2-(trifluoromethoxy)phenyl]methylamino]propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17464973 |
| Molecular Formula | C16H15F3N2O4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[3-oxo-3-[[2-(trifluoromethoxy)phenyl]methylamino]propyl]furan-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccco1)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O4/c17-16(18,19)25-12-5-2-1-4-11(12)10-21-14(22)7-8-20-15(23)13-6-3-9-24-13/h1-6,9H,7-8,10H2,(H,20,23)(H,21,22) |
| InChIKey | KPNCFAPKSYJRFH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |