C20H19N3O4 — CID 42385642
N-[3-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-3-oxopropyl]furan-2-carboxamide (PubChem CID 42385642) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-[3-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42385642 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[3-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-3-oxopropyl]furan-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccco1)NNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C20H19N3O4/c24-18(10-11-21-20(26)17-9-4-12-27-17)22-23-19(25)13-15-7-3-6-14-5-1-2-8-16(14)15/h1-9,12H,10-11,13H2,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | YIBPYFBRBOZPKG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|