C22H23N3O4 — CID 17471674
N-[3-methyl-1-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-1-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 17471674) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[3-methyl-1-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-1-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | N-[3-methyl-1-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-1-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17471674 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[3-methyl-1-[2-(2-naphthalen-1-ylacetyl)hydrazinyl]-1-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | CC(C)C(NC(=O)c1ccco1)C(=O)NNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C22H23N3O4/c1-14(2)20(23-21(27)18-11-6-12-29-18)22(28)25-24-19(26)13-16-9-5-8-15-7-3-4-10-17(15)16/h3-12,14,20H,13H2,1-2H3,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | MJUFSFACOOESTO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|