C13H18N2O6 — CID 66002517
4-[3-(furan-2-carbonylamino)propanoylamino]-3-hydroxy-3-methylbutanoic acid (PubChem CID 66002517) has the molecular formula C13H18N2O6 and a molecular weight of 298.29 g/mol. Its IUPAC name is 4-[3-(furan-2-carbonylamino)propanoylamino]-3-hydroxy-3-methylbutanoic acid.
| Compound Name | 4-[3-(furan-2-carbonylamino)propanoylamino]-3-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66002517 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-[3-(furan-2-carbonylamino)propanoylamino]-3-hydroxy-3-methylbutanoic acid |
| SMILES | CC(O)(CNC(=O)CCNC(=O)c1ccco1)CC(=O)O |
| InChI | InChI=1S/C13H18N2O6/c1-13(20,7-11(17)18)8-15-10(16)4-5-14-12(19)9-3-2-6-21-9/h2-3,6,20H,4-5,7-8H2,1H3,(H,14,19)(H,15,16)(H,17,18) |
| InChIKey | FEVUAEHPDWJHCY-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |