C12H16N2O6 — CID 66003494
4-[[2-(furan-2-carbonylamino)acetyl]amino]-3-hydroxy-3-methylbutanoic acid (PubChem CID 66003494) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 4-[[2-(furan-2-carbonylamino)acetyl]amino]-3-hydroxy-3-methylbutanoic acid.
| Compound Name | 4-[[2-(furan-2-carbonylamino)acetyl]amino]-3-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66003494 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-[[2-(furan-2-carbonylamino)acetyl]amino]-3-hydroxy-3-methylbutanoic acid |
| SMILES | CC(O)(CNC(=O)CNC(=O)c1ccco1)CC(=O)O |
| InChI | InChI=1S/C12H16N2O6/c1-12(19,5-10(16)17)7-14-9(15)6-13-11(18)8-3-2-4-20-8/h2-4,19H,5-7H2,1H3,(H,13,18)(H,14,15)(H,16,17) |
| InChIKey | MXCHNBIIWBMMKX-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |