C14H21N3O5 — CID 108537102
tert-butyl N-[2-[2-(furan-2-carbonylamino)ethylamino]-2-oxoethyl]carbamate (PubChem CID 108537102) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(furan-2-carbonylamino)ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(furan-2-carbonylamino)ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108537102 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | tert-butyl N-[2-[2-(furan-2-carbonylamino)ethylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C14H21N3O5/c1-14(2,3)22-13(20)17-9-11(18)15-6-7-16-12(19)10-5-4-8-21-10/h4-5,8H,6-7,9H2,1-3H3,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | UHYCEVZGMIITMD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|