C19H23N3O5 — CID 42014589
tert-butyl N-[3-[4-(furan-2-carbonylamino)anilino]-3-oxopropyl]carbamate (PubChem CID 42014589) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(furan-2-carbonylamino)anilino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(furan-2-carbonylamino)anilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 42014589 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | tert-butyl N-[3-[4-(furan-2-carbonylamino)anilino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)Nc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C19H23N3O5/c1-19(2,3)27-18(25)20-11-10-16(23)21-13-6-8-14(9-7-13)22-17(24)15-5-4-12-26-15/h4-9,12H,10-11H2,1-3H3,(H,20,25)(H,21,23)(H,22,24) |
| InChIKey | CCZDYZJXHWUQCL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |