C24H25N3O5 — CID 46559187
tert-butyl N-[4-[2-[3-(furan-2-carbonylamino)anilino]-2-oxoethyl]phenyl]carbamate (PubChem CID 46559187) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[3-(furan-2-carbonylamino)anilino]-2-oxoethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[3-(furan-2-carbonylamino)anilino]-2-oxoethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 46559187 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | tert-butyl N-[4-[2-[3-(furan-2-carbonylamino)anilino]-2-oxoethyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CC(=O)Nc2cccc(NC(=O)c3ccco3)c2)cc1 |
| InChI | InChI=1S/C24H25N3O5/c1-24(2,3)32-23(30)27-17-11-9-16(10-12-17)14-21(28)25-18-6-4-7-19(15-18)26-22(29)20-8-5-13-31-20/h4-13,15H,14H2,1-3H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | IRSKOCGBGCZXAQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |