C17H29N5O4 — CID 111887057
tert-butyl N-[3-[[N-[2-(furan-2-carbonylamino)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111887057) has the molecular formula C17H29N5O4 and a molecular weight of 367.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[2-(furan-2-carbonylamino)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-[2-(furan-2-carbonylamino)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887057 |
| Molecular Formula | C17H29N5O4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | tert-butyl N-[3-[[N-[2-(furan-2-carbonylamino)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C17H29N5O4/c1-17(2,3)26-16(24)22-9-6-8-20-15(18-4)21-11-10-19-14(23)13-7-5-12-25-13/h5,7,12H,6,8-11H2,1-4H3,(H,19,23)(H,22,24)(H2,18,20,21) |
| InChIKey | UNWZPJKQUROQNH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|