C18H34IN5O3 — CID 111886826
tert-butyl N-[3-[[N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111886826) has the molecular formula C18H34IN5O3 and a molecular weight of 495.41 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886826 |
| Molecular Formula | C18H34IN5O3 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | tert-butyl N-[3-[[N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCC(c1ccco1)N(C)C.I |
| InChI | InChI=1S/C18H33N5O3.HI/c1-18(2,3)26-17(24)21-11-8-10-20-16(19-4)22-13-14(23(5)6)15-9-7-12-25-15;/h7,9,12,14H,8,10-11,13H2,1-6H3,(H,21,24)(H2,19,20,22);1H |
| InChIKey | SRUPVVWZNOGPCO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|