C16H28N4O4 — CID 95699804
tert-butyl N-[2-[[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]carbamoylamino]ethyl]carbamate (PubChem CID 95699804) has the molecular formula C16H28N4O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]carbamoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]carbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 95699804 |
| Molecular Formula | C16H28N4O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | tert-butyl N-[2-[[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]carbamoylamino]ethyl]carbamate |
| SMILES | CN(C)[C@H](CNC(=O)NCCNC(=O)OC(C)(C)C)c1ccco1 |
| InChI | InChI=1S/C16H28N4O4/c1-16(2,3)24-15(22)18-9-8-17-14(21)19-11-12(20(4)5)13-7-6-10-23-13/h6-7,10,12H,8-9,11H2,1-5H3,(H,18,22)(H2,17,19,21)/t12-/m1/s1 |
| InChIKey | ZTMCUHIEFZGBKV-GFCCVEGCSA-N |
| XLogP | 1.71 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|