C19H27N3O3 — CID 95695143
1-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[3-(4-methylphenoxy)propyl]urea (PubChem CID 95695143) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[3-(4-methylphenoxy)propyl]urea.
| Compound Name | 1-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[3-(4-methylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 95695143 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[3-(4-methylphenoxy)propyl]urea |
| SMILES | Cc1ccc(OCCCNC(=O)NC[C@H](c2ccco2)N(C)C)cc1 |
| InChI | InChI=1S/C19H27N3O3/c1-15-7-9-16(10-8-15)24-13-5-11-20-19(23)21-14-17(22(2)3)18-6-4-12-25-18/h4,6-10,12,17H,5,11,13-14H2,1-3H3,(H2,20,21,23)/t17-/m1/s1 |
| InChIKey | WKDIIWHPXCXPQI-QGZVFWFLSA-N |
| XLogP | 2.96 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|