C18H30N4O3 — CID 60547761
N-cyclohexyl-3-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]carbamoylamino]propanamide (PubChem CID 60547761) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-cyclohexyl-3-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]carbamoylamino]propanamide.
| Compound Name | N-cyclohexyl-3-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]carbamoylamino]propanamide |
|---|---|
| PubChem CID | 60547761 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | N-cyclohexyl-3-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]carbamoylamino]propanamide |
| SMILES | CN(C)C(CNC(=O)NCCC(=O)NC1CCCCC1)c1ccco1 |
| InChI | InChI=1S/C18H30N4O3/c1-22(2)15(16-9-6-12-25-16)13-20-18(24)19-11-10-17(23)21-14-7-4-3-5-8-14/h6,9,12,14-15H,3-5,7-8,10-11,13H2,1-2H3,(H,21,23)(H2,19,20,24) |
| InChIKey | XFOBXXVISKFXMJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |