C11H16N2O4 — CID 43390516
N-[2-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 43390516) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-[2-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43390516 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-[2-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | CC(C)(CO)NC(=O)CNC(=O)c1ccco1 |
| InChI | InChI=1S/C11H16N2O4/c1-11(2,7-14)13-9(15)6-12-10(16)8-4-3-5-17-8/h3-5,14H,6-7H2,1-2H3,(H,12,16)(H,13,15) |
| InChIKey | AUCAOGYYCHDVLA-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |