C12H18N2O5 — CID 103602259
N-[2-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 103602259) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is N-[2-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 103602259 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-[2-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | CCC(CO)(CO)NC(=O)CNC(=O)c1ccco1 |
| InChI | InChI=1S/C12H18N2O5/c1-2-12(7-15,8-16)14-10(17)6-13-11(18)9-4-3-5-19-9/h3-5,15-16H,2,6-8H2,1H3,(H,13,18)(H,14,17) |
| InChIKey | MYBSOWXGHLYPND-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |