C13H20N2O4 — CID 104709146
N-[2-[(1-hydroxy-3-methylpentan-3-yl)amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 104709146) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N-[2-[(1-hydroxy-3-methylpentan-3-yl)amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(1-hydroxy-3-methylpentan-3-yl)amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 104709146 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[2-[(1-hydroxy-3-methylpentan-3-yl)amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | CCC(C)(CCO)NC(=O)CNC(=O)c1ccco1 |
| InChI | InChI=1S/C13H20N2O4/c1-3-13(2,6-7-16)15-11(17)9-14-12(18)10-5-4-8-19-10/h4-5,8,16H,3,6-7,9H2,1-2H3,(H,14,18)(H,15,17) |
| InChIKey | HWCVAFHSGFCMTC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |