C12H15F3N2O2 — CID 60703728
2-(ethylamino)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide (PubChem CID 60703728) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-(ethylamino)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(ethylamino)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 60703728 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-(ethylamino)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide |
| SMILES | CCNCC(=O)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2/c1-2-16-8-11(18)17-7-9-5-3-4-6-10(9)19-12(13,14)15/h3-6,16H,2,7-8H2,1H3,(H,17,18) |
| InChIKey | LXQKSCNAUDOJEA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |