C17H14F3IN2O3 — CID 34321952
2-iodo-N-[2-oxo-2-[[2-(trifluoromethoxy)phenyl]methylamino]ethyl]benzamide (PubChem CID 34321952) has the molecular formula C17H14F3IN2O3 and a molecular weight of 478.21 g/mol. Its IUPAC name is 2-iodo-N-[2-oxo-2-[[2-(trifluoromethoxy)phenyl]methylamino]ethyl]benzamide.
| Compound Name | 2-iodo-N-[2-oxo-2-[[2-(trifluoromethoxy)phenyl]methylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 34321952 |
| Molecular Formula | C17H14F3IN2O3 |
| Molecular Weight | 478.21 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | 2-iodo-N-[2-oxo-2-[[2-(trifluoromethoxy)phenyl]methylamino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1I)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C17H14F3IN2O3/c18-17(19,20)26-14-8-4-1-5-11(14)9-22-15(24)10-23-16(25)12-6-2-3-7-13(12)21/h1-8H,9-10H2,(H,22,24)(H,23,25) |
| InChIKey | OJJMIMIHLDRWDG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|