C17H24F3N3O4 — CID 154911848
2-(4-ethylpiperazin-1-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide;formic acid (PubChem CID 154911848) has the molecular formula C17H24F3N3O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide;formic acid.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide;formic acid |
|---|---|
| PubChem CID | 154911848 |
| Molecular Formula | C17H24F3N3O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-N-[[2-(trifluoromethoxy)phenyl]methyl]acetamide;formic acid |
| SMILES | CCN1CCN(CC(=O)NCc2ccccc2OC(F)(F)F)CC1.O=CO |
| InChI | InChI=1S/C16H22F3N3O2.CH2O2/c1-2-21-7-9-22(10-8-21)12-15(23)20-11-13-5-3-4-6-14(13)24-16(17,18)19;2-1-3/h3-6H,2,7-12H2,1H3,(H,20,23);1H,(H,2,3) |
| InChIKey | SCACYOCCLMJLBN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|