C15H15ClFNOS2 — CID 37017604
2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[(4-fluoro-3-methylphenyl)methyl]acetamide (PubChem CID 37017604) has the molecular formula C15H15ClFNOS2 and a molecular weight of 343.88 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[(4-fluoro-3-methylphenyl)methyl]acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[(4-fluoro-3-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 37017604 |
| Molecular Formula | C15H15ClFNOS2 |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methylsulfanyl]-N-[(4-fluoro-3-methylphenyl)methyl]acetamide |
| SMILES | Cc1cc(CNC(=O)CSCc2ccc(Cl)s2)ccc1F |
| InChI | InChI=1S/C15H15ClFNOS2/c1-10-6-11(2-4-13(10)17)7-18-15(19)9-20-8-12-3-5-14(16)21-12/h2-6H,7-9H2,1H3,(H,18,19) |
| InChIKey | QNVJBOVXPQGMER-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |