C14H13BrClNOS2 — CID 33295688
N-[(5-bromothiophen-2-yl)methyl]-2-[(4-chlorophenyl)methylsulfanyl]acetamide (PubChem CID 33295688) has the molecular formula C14H13BrClNOS2 and a molecular weight of 390.76 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-[(4-chlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-[(4-chlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 33295688 |
| Molecular Formula | C14H13BrClNOS2 |
| Molecular Weight | 390.76 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-[(4-chlorophenyl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)cc1)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C14H13BrClNOS2/c15-13-6-5-12(20-13)7-17-14(18)9-19-8-10-1-3-11(16)4-2-10/h1-6H,7-9H2,(H,17,18) |
| InChIKey | JWBFIOYWOYRBIY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.76 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |