C13H11BrClNO2S — CID 32775706
N-[(5-bromothiophen-2-yl)methyl]-2-(4-chlorophenoxy)acetamide (PubChem CID 32775706) has the molecular formula C13H11BrClNO2S and a molecular weight of 360.66 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-(4-chlorophenoxy)acetamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-(4-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 32775706 |
| Molecular Formula | C13H11BrClNO2S |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 358.94 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-(4-chlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H11BrClNO2S/c14-12-6-5-11(19-12)7-16-13(17)8-18-10-3-1-9(15)2-4-10/h1-6H,7-8H2,(H,16,17) |
| InChIKey | LXIYPHSIFCUWMA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |