C20H17ClN2O5S2 — CID 55791868
2-[4-(4-chlorobenzoyl)phenoxy]-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide (PubChem CID 55791868) has the molecular formula C20H17ClN2O5S2 and a molecular weight of 464.95 g/mol. Its IUPAC name is 2-[4-(4-chlorobenzoyl)phenoxy]-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[4-(4-chlorobenzoyl)phenoxy]-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 55791868 |
| Molecular Formula | C20H17ClN2O5S2 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 2-[4-(4-chlorobenzoyl)phenoxy]-N-[(5-sulfamoylthiophen-2-yl)methyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)COc2ccc(C(=O)c3ccc(Cl)cc3)cc2)s1 |
| InChI | InChI=1S/C20H17ClN2O5S2/c21-15-5-1-13(2-6-15)20(25)14-3-7-16(8-4-14)28-12-18(24)23-11-17-9-10-19(29-17)30(22,26)27/h1-10H,11-12H2,(H,23,24)(H2,22,26,27) |
| InChIKey | WKRMCIYVIKUBML-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |