C21H17ClN2O4S — CID 55443698
2-[4-(4-chlorobenzoyl)phenoxy]-N-(thiophen-2-ylmethylcarbamoyl)acetamide (PubChem CID 55443698) has the molecular formula C21H17ClN2O4S and a molecular weight of 428.90 g/mol. Its IUPAC name is 2-[4-(4-chlorobenzoyl)phenoxy]-N-(thiophen-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[4-(4-chlorobenzoyl)phenoxy]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 55443698 |
| Molecular Formula | C21H17ClN2O4S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 2-[4-(4-chlorobenzoyl)phenoxy]-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
| SMILES | O=C(COc1ccc(C(=O)c2ccc(Cl)cc2)cc1)NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C21H17ClN2O4S/c22-16-7-3-14(4-8-16)20(26)15-5-9-17(10-6-15)28-13-19(25)24-21(27)23-12-18-2-1-11-29-18/h1-11H,12-13H2,(H2,23,24,25,27) |
| InChIKey | DFJKNZIYFHVGQD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |