C20H23N3O4S — CID 9473607
[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-(pyrrolidin-1-ylmethyl)benzoate (PubChem CID 9473607) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-(pyrrolidin-1-ylmethyl)benzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-(pyrrolidin-1-ylmethyl)benzoate |
|---|---|
| PubChem CID | 9473607 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-(pyrrolidin-1-ylmethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(CN2CCCC2)cc1)NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C20H23N3O4S/c24-18(22-20(26)21-12-17-4-3-11-28-17)14-27-19(25)16-7-5-15(6-8-16)13-23-9-1-2-10-23/h3-8,11H,1-2,9-10,12-14H2,(H2,21,22,24,26) |
| InChIKey | UBQSKAOLKISPKY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |