C17H15N5O4S — CID 55522584
[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 6-pyrazol-1-ylpyridine-3-carboxylate (PubChem CID 55522584) has the molecular formula C17H15N5O4S and a molecular weight of 385.41 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 6-pyrazol-1-ylpyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 6-pyrazol-1-ylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 55522584 |
| Molecular Formula | C17H15N5O4S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 6-pyrazol-1-ylpyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(-n2cccn2)nc1)NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C17H15N5O4S/c23-15(21-17(25)19-10-13-3-1-8-27-13)11-26-16(24)12-4-5-14(18-9-12)22-7-2-6-20-22/h1-9H,10-11H2,(H2,19,21,23,25) |
| InChIKey | YQKCJNUTYUEWGM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |