C18H17N3O3S — CID 8956273
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-pyrazol-1-ylbenzoate (PubChem CID 8956273) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-pyrazol-1-ylbenzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-pyrazol-1-ylbenzoate |
|---|---|
| PubChem CID | 8956273 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-pyrazol-1-ylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(-n2cccn2)cc1)NCCc1cccs1 |
| InChI | InChI=1S/C18H17N3O3S/c22-17(19-10-8-16-3-1-12-25-16)13-24-18(23)14-4-6-15(7-5-14)21-11-2-9-20-21/h1-7,9,11-12H,8,10,13H2,(H,19,22) |
| InChIKey | UZMKMMQYXDEQMY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |