C16H19ClN2O4S2 — CID 39793693
N-[[5-[2-(4-chlorophenoxy)ethyl-methylsulfamoyl]thiophen-2-yl]methyl]acetamide (PubChem CID 39793693) has the molecular formula C16H19ClN2O4S2 and a molecular weight of 402.93 g/mol. Its IUPAC name is N-[[5-[2-(4-chlorophenoxy)ethyl-methylsulfamoyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-(4-chlorophenoxy)ethyl-methylsulfamoyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 39793693 |
| Molecular Formula | C16H19ClN2O4S2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | N-[[5-[2-(4-chlorophenoxy)ethyl-methylsulfamoyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)N(C)CCOc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C16H19ClN2O4S2/c1-12(20)18-11-15-7-8-16(24-15)25(21,22)19(2)9-10-23-14-5-3-13(17)4-6-14/h3-8H,9-11H2,1-2H3,(H,18,20) |
| InChIKey | XFKLOLKFQBKEAT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |